Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
HOG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.2790±0.0890955 |
Normalized OD Score: sc h |
0.4390±0.110137 |
Z-Score: |
-15.2159±0.461131 |
p-Value: |
0 |
Z-Factor: |
0.0864505 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 16|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.09075±0.00507 | Plate DMSO Control (-): | 0.8035000000000001±0.04907 | Plate Z-Factor: | 0.7641 |
| png ps pdf |
4447643 |
methyl 4-[4-(4-methoxycarbonylcyclohexyl)butyl]cyclohexane-1-carboxylate |
4464875 |
methyl 10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxyl ate |
4465410 |
methyl 2-[4-(methoxycarbonylmethyl)-4,9,10,13-tetramethyl-15-propan-2-yl-2,3,5,6,7,8,11,12,14,15,16,17-dodecahy dro-1H-cyclopenta[a]phenanthren-3-yl]-2-methyl-propanoate |
4580601 |
methyl 19-methylicosanoate |
4589707 |
methyl 6,11-dioxododecanoate |
4644897 |
methyl 2-methyl-4-tert-butyl-cyclohexane-1-carboxylate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|