Compound Information | SONAR Target prediction | Name: | LANOSTEROL | Unique Identifier: | SPE00240470 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H50O | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5710±0.00148492 |
Normalized OD Score: sc h |
0.9976±0.00617171 |
Z-Score: |
-0.1145±0.306372 |
p-Value: |
0.829594 |
Z-Factor: |
-12.7445 |
Fitness Defect: |
0.1868 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.90 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.040625±0.00072 | Plate DMSO Control (-): | 0.5622±0.04923 | Plate Z-Factor: | 0.6809 |
| png ps pdf |
330 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenan thren-3-ol |
420 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenan thren-3-ol |
856 |
4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a] phenanthren-3-ol |
3882 |
4,4,10,13,14,17-hexamethyl-17-(6-methylhept-5-en-2-yl)-1,2,3,5,6,7,11,12,15,16-decahydrocyclopenta[a]phe nanthren-3-ol |
6606 |
(3S,5S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-de cahydro-1H-cyclopenta[a]phenanthren-3-ol |
65172 |
(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methyl-5-methylidene-heptan-2-yl]-2,3,5,6,7,11, 12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|