| Compound Information | SONAR Target prediction | | Name: | LANOSTEROL | | Unique Identifier: | SPE00240470 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H50O | | Molecular Weight: | 376.32 g/mol | | X log p: | 2.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
DBP3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6139±0.0236174 |
| Normalized OD Score: sc h |
0.8747±0.0154993 |
| Z-Score: |
-6.5180±1.0459 |
| p-Value: |
0.00000000377038 |
| Z-Factor: |
-4.80182 |
| Fitness Defect: |
19.3961 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|G6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.70 Celcius | | Date: | 2007-09-13 YYYY-MM-DD | | Plate CH Control (+): | 0.040025±0.00048 | | Plate DMSO Control (-): | 0.6933499999999999±0.11428 | | Plate Z-Factor: | 0.4428 |
| png ps pdf |
| 7092803 |
(3R,5S,9R,10R,13S,14S,17R)-17-[(E,2S,5R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11, 12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 7093007 |
(3S,4aR,6aS,6bS,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
| 7093008 |
(3S,4aS,6aS,6bS,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
| 7093734 |
(3S,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
| 7093735 |
(3R,4aR,6aS,6bS,8aR,12aS,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
| 7093736 |
(3R,4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
| internal high similarity DBLink | Rows returned: 11 | << Back 1 2 |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|