Compound Information | SONAR Target prediction | Name: | LANOSTEROL | Unique Identifier: | SPE00240470 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H50O | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
DBP3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6139±0.0236174 |
Normalized OD Score: sc h |
0.8747±0.0154993 |
Z-Score: |
-6.5180±1.0459 |
p-Value: |
0.00000000377038 |
Z-Factor: |
-4.80182 |
Fitness Defect: |
19.3961 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2007-09-13 YYYY-MM-DD | Plate CH Control (+): | 0.040025±0.00048 | Plate DMSO Control (-): | 0.6933499999999999±0.11428 | Plate Z-Factor: | 0.4428 |
| png ps pdf |
7091808 |
(3S,4R,5S,9S,10R,13S,14S,17R)-4,10,13-trimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,1 2,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7091809 |
(3S,4R,5S,9R,10R,13S,14R,17R)-4,10,13-trimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,1 2,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7091810 |
(3S,4R,5S,9R,10R,13S,14S,17R)-4,10,13-trimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,1 2,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7092800 |
(3R,5S,9S,10R,13S,14R,17R)-17-[(E,2S,5R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11, 12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7092801 |
(3R,5S,9S,10R,13S,14S,17R)-17-[(E,2S,5R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11, 12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7092802 |
(3R,5S,9R,10R,13S,14R,17R)-17-[(E,2S,5R)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11, 12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|