Compound Information | SONAR Target prediction | Name: | LANOSTEROL | Unique Identifier: | SPE00240470 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H50O | Molecular Weight: | 376.32 g/mol | X log p: | 2.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC=C(C)C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4335±0.0609526 |
Normalized OD Score: sc h |
0.8222±0.0123146 |
Z-Score: |
-5.9348±1.26836 |
p-Value: |
0.000000235352 |
Z-Factor: |
-3.03155 |
Fitness Defect: |
15.2622 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|G6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.0395±0.00061 | Plate DMSO Control (-): | 0.5116499999999999±0.09917 | Plate Z-Factor: | 0.3262 |
| png ps pdf |
472761 |
(3S,5S,10S,13S,14S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-d ecahydro-1H-cyclopenta[a]phenanthren-3-ol |
487265 |
(3S,10S,13S,14R)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren -3-ol |
489917 |
(3S,5S,8S,10S,13R,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methyl-5-methylidene-heptan-2-yl]-2,3,5,6 ,7,8,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
518662 |
10,13-dimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phe nanthren-3-ol |
521030 |
n/a |
521216 |
2-(4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl)propan-2-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 2 | |
|