Compound Information | SONAR Target prediction | Name: | OLEANOLIC ACID ACETATE | Unique Identifier: | SPE00102058 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 448.34 g/mol | X log p: | 1.523 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Class: | triterpene | Source: | birch bark | Reference: | J Chem Soc 1939: 1047 |
Species: |
4932 |
Condition: |
CNB1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8569±0.0267286 |
Normalized OD Score: sc h |
1.0301±0.0354617 |
Z-Score: |
1.4756±1.73313 |
p-Value: |
0.404698 |
Z-Factor: |
-5.3516 |
Fitness Defect: |
0.9046 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|G4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-03-03 YYYY-MM-DD | Plate CH Control (+): | 0.038025±0.00167 | Plate DMSO Control (-): | 0.8112±0.01814 | Plate Z-Factor: | 0.9399 |
| png ps pdf |
151202 |
(4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
470642 |
(4aS,6aS,6bR,10S,12aS)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-te tradecahydropicene-4a-carboxylic acid |
619164 |
10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene- 4a-carboxylic acid |
619165 |
10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-c arboxylic acid |
3084011 |
(1S,2R,6aS,6aS,6bR,8aS,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13, 14b-tetradecahydro-1H-picene-4a-carboxylic acid |
5315977 |
(4aS,6bR,10S,12aS,14bR)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-t etradecahydropicene-4a-carboxylic acid |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 4 | |
|