Compound Information | SONAR Target prediction | Name: | OLEANOLIC ACID ACETATE | Unique Identifier: | SPE00102058 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 448.34 g/mol | X log p: | 1.523 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Class: | triterpene | Source: | birch bark | Reference: | J Chem Soc 1939: 1047 |
Species: |
4932 |
Condition: |
ARL3 |
Replicates: |
2 |
Raw OD Value: r im |
0.5612±0.0297692 |
Normalized OD Score: sc h |
0.8328±0.0250932 |
Z-Score: |
-7.8676±0.889127 |
p-Value: |
0.000000000000226232 |
Z-Factor: |
0.179574 |
Fitness Defect: |
29.1172 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|F8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-06-11 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00044 | Plate DMSO Control (-): | 0.6753±0.01421 | Plate Z-Factor: | 0.9468 |
| png ps pdf |
151202 |
(4aS,6aS,6aS,6bR,8aS,10S,12aS,14bR)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11 ,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
470642 |
(4aS,6aS,6bR,10S,12aS)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-te tradecahydropicene-4a-carboxylic acid |
619164 |
10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene- 4a-carboxylic acid |
619165 |
10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-c arboxylic acid |
3084011 |
(1S,2R,6aS,6aS,6bR,8aS,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13, 14b-tetradecahydro-1H-picene-4a-carboxylic acid |
5315977 |
(4aS,6bR,10S,12aS,14bR)-10-acetyloxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-t etradecahydropicene-4a-carboxylic acid |
internal high similarity DBLink | Rows returned: 2 | |
nonactive | Cluster 1623 | Additional Members: 8 | Rows returned: 6 | |
|