| Compound Information | SONAR Target prediction |
| Name: | PTAEROXYLIN |
| Unique Identifier: | SPE00100513 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 6.787 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1COc2cc3OC(C)=CC(=O)c3c(O)c2CC=1 |
| Class: | chromone |
| Source: | Ptaeroxylon obliquum, Cedrelopsis grevei |
| Reference: | J Chem Soc (C) 1966:114; 1967:145; Tet Lett 1967:3459 |
| Found: 55 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [55] |
| Species: | 4932 |
| Condition: | PEX11 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6377±0.011243 |
| Normalized OD Score: sc h | 0.9221±0.0114356 |
| Z-Score: | -4.5282±0.278947 |
| p-Value: | 0.00000856964 |
| Z-Factor: | -0.0589589 |
| Fitness Defect: | 11.6673 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 3646533 |
| internal high similarity DBLink | Rows returned: 0 |
| nonactive | Cluster 4376 | Additional Members: 4 | Rows returned: 3 |
| SPE00200447 | 0.542372881355932 |
| SPE00100531 | 0.442622950819672 |
| SPE00100719 | 0 |
Service provided by the
Mike Tyers Laboratory