Compound Information | SONAR Target prediction | Name: | Thiamphenicol | Unique Identifier: | Prest885 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12Cl2H15NO5S | Molecular Weight: | 341.104 g/mol | X log p: | 7.295 (online calculus) | Lipinksi Failures | 1 | TPSA | 59.59 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 7 | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl |
Species: |
9606 |
Condition: |
TMPPre001 |
Replicates: |
2 |
Raw OD Value: r im |
1901.0000±0 |
Normalized OD Score: sc h |
0.9134±0 |
Z-Score: |
-1.9523±0 |
p-Value: |
0.0509016 |
Z-Factor: |
-97.2827 |
Fitness Defect: |
2.9779 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 1|C6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 1020±963.92163 | Plate DMSO Control (-): | 2084±569.64618 | Plate Z-Factor: | -4.4103 |
| png ps pdf |
DBLink | Rows returned: 3 | |
5433 |
2,2-dichloro-N-[1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
27200 |
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
146678 |
2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 681 | Additional Members: 8 | Rows returned: 6 | |
|