| Compound Information | SONAR Target prediction | | Name: | THIAMPHENICOL | | Unique Identifier: | SPE01503136 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 341.104 g/mol | | X log p: | 7.295 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 59.59 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 7 | | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CO)NC(=O)C(Cl)Cl | | Source: | synthetic | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8690±0.0131522 |
| Normalized OD Score: sc h |
1.0026±0.00859717 |
| Z-Score: |
0.0241±0.168431 |
| p-Value: |
0.905224 |
| Z-Factor: |
-7.56255 |
| Fitness Defect: |
0.0996 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum_ED | | Plate Number and Position: | 7|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 595 nm | | Robot Temperature: | 30.00 Celcius | | Date: | 2010-08-10 YYYY-MM-DD | | Plate CH Control (+): | 0.09475±0.00655 | | Plate DMSO Control (-): | 0.9557500000000001±0.02304 | | Plate Z-Factor: | 0.8724 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 5433 |
2,2-dichloro-N-[1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| 27200 |
2,2-dichloro-N-[(1R,2R)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| 146678 |
2,2-dichloro-N-[(1S,2S)-1,3-dihydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 681 | Additional Members: 8 | Rows returned: 0 | |
|
