Compound Information | SONAR Target prediction | Name: | Dehydrocholic acid | Unique Identifier: | Prest498 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C24H34O5 | Molecular Weight: | 372.286 g/mol | X log p: | -1.791 (online calculus) | Lipinksi Failures | 0 | TPSA | 68.28 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(CC(=O)C12C)C1(C)CCC(=O)CC1CC3=O |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
18432.0000±0 |
Normalized OD Score: sc h |
0.9929±0 |
Z-Score: |
-0.1982±0 |
p-Value: |
0.842858 |
Z-Factor: |
-23.9123 |
Fitness Defect: |
0.171 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 2|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.40 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 18614.5±2372.77494 | Plate DMSO Control (-): | 18453±1651.99066 | Plate Z-Factor: | -21.7740 |
| png ps pdf |
7200747 |
(4R)-4-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoate |
7200748 |
(4R)-4-[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
7200750 |
(4R)-4-[(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoate |
7200751 |
(4R)-4-[(5R,8R,9S,10S,13S,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydro cyclopenta[a]phenanthren-17-yl]pentanoic acid |
11825274 |
4-[(5S,8S,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7-dioxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-17-yl]pentanoic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7145 | Additional Members: 4 | Rows returned: 1 | |
|