Compound Information | SONAR Target prediction | Name: | Thioguanosine | Unique Identifier: | Prest466 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H13N5O4S | Molecular Weight: | 286.204 g/mol | X log p: | 0.412 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1nc(S)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
15076.0000±0 |
Normalized OD Score: sc h |
0.8318±0 |
Z-Score: |
-4.6791±0 |
p-Value: |
0.00000288182 |
Z-Factor: |
-0.013092 |
Fitness Defect: |
12.7571 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 5|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 18290±2002.70234 | Plate DMSO Control (-): | 18264.5±1013.26960 | Plate Z-Factor: | -63.2184 |
| png ps pdf |
DBLink | Rows returned: 5 | |
7058183 |
2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
7458585 |
2-amino-9-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
7458588 |
2-amino-9-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
7458592 |
2-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
7458597 |
2-amino-9-[(2R,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
internal high similarity DBLink | Rows returned: 0 | |
|