| Compound Information | SONAR Target prediction | | Name: | Thioguanosine | | Unique Identifier: | Prest466 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10H13N5O4S | | Molecular Weight: | 286.204 g/mol | | X log p: | 0.412 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Nc1nc(S)c2ncn(C3OC(CO)C(O)C3O)c2n1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
1843.0000±0 |
| Normalized OD Score: sc h |
0.9060±0 |
| Z-Score: |
-2.1177±0 |
| p-Value: |
0.034203 |
| Z-Factor: |
-103.4 |
| Fitness Defect: |
3.3754 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 5|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.80 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 967.5±954.39230 | | Plate DMSO Control (-): | 2031±542.13094 | | Plate Z-Factor: | -4.5046 |
| png ps pdf |
| DBLink | Rows returned: 5 | |
| 7058183 |
2-amino-9-[(2R,3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
| 7458585 |
2-amino-9-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
| 7458588 |
2-amino-9-[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
| 7458592 |
2-amino-9-[(2S,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
| 7458597 |
2-amino-9-[(2R,3S,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purine-6-thiolate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9750 | Additional Members: 25 | Rows returned: 3 | |
|