Compound Information | SONAR Target prediction | Name: | Florfenicol | Unique Identifier: | Prest1164 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12Cl2FH14NO4S | Molecular Weight: | 344.103 g/mol | X log p: | 8.137 (online calculus) | Lipinksi Failures | 1 | TPSA | 59.59 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 7 | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CF)NC(=O)C(Cl)Cl |
Species: |
9606 |
Condition: |
TMPPre001 |
Replicates: |
2 |
Raw OD Value: r im |
897.0000±0 |
Normalized OD Score: sc h |
0.9571±0 |
Z-Score: |
-0.9662±0 |
p-Value: |
0.33393 |
Z-Factor: |
-18.2319 |
Fitness Defect: |
1.0968 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 12|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.30 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 758.5±653.58671 | Plate DMSO Control (-): | 822.5±277.54018 | Plate Z-Factor: | -66.6597 |
| png ps pdf |
DBLink | Rows returned: 3 | |
114811 |
2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
5201447 |
2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
6604432 |
2,2-dichloro-N-[(1S,2R)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 681 | Additional Members: 8 | Rows returned: 6 | |
|