| Compound Information | SONAR Target prediction |  | Name: | Florfenicol |  | Unique Identifier: | Prest1164  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C12Cl2FH14NO4S |  | Molecular Weight: | 344.103 g/mol |  | X log p: | 8.137  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 59.59 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 7 |  | Canonical Smiles: | CS(=O)(=O)c1ccc(cc1)C(O)C(CF)NC(=O)C(Cl)Cl |  
 
 
	
		| Species: | 
		9606 | 
	 
	
		| Condition: | 
		TMPPre001 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		897.0000±0 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9571±0 | 
	 
	
		| Z-Score: | 
		-0.9662±0 | 
	 
	
		| p-Value: | 
		0.33393 | 
	 
	
		| Z-Factor: | 
		-18.2319 | 
	 
	
		| Fitness Defect: | 
		1.0968 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 12|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.30 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 758.5±653.58671 |  | Plate DMSO Control (-): | 822.5±277.54018 |  | Plate Z-Factor: | -66.6597 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 114811 | 
		2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 5201447 | 
		2,2-dichloro-N-[3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
	
		| 6604432 | 
		2,2-dichloro-N-[(1S,2R)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 681 | Additional Members: 8 | Rows returned: 0 |  |  
  
 |