Compound Information | SONAR Target prediction | Name: | Emodin | Unique Identifier: | LOPAC 00595 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H10O5 | Molecular Weight: | 260.158 g/mol | X log p: | 7.787 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 0 | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cc(O)cc3c(=O)c2c1 | Class: | Phosphorylation | Action: | Inhibitor | Selectivity: | p56lck TK |
Species: |
4932 |
Condition: |
WHI3 |
Replicates: |
2 |
Raw OD Value: r im |
0.5041±0.00997021 |
Normalized OD Score: sc h |
0.7270±0.0142716 |
Z-Score: |
-10.5913±2.26696 |
p-Value: |
1.25523e-19 |
Z-Factor: |
0.546338 |
Fitness Defect: |
43.5218 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 7|H3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-20 YYYY-MM-DD | Plate CH Control (+): | 0.044475±0.00083 | Plate DMSO Control (-): | 0.6608749999999999±0.01708 | Plate Z-Factor: | 0.9244 |
| png ps pdf |
DBLink | Rows returned: 1 | |
3220 |
1,6,8-trihydroxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|