| Compound Information | SONAR Target prediction | | Name: | Emodin | | Unique Identifier: | LOPAC 00595 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C15H10O5 | | Molecular Weight: | 260.158 g/mol | | X log p: | 7.787 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cc1cc(O)c2c(=O)c3c(O)cc(O)cc3c(=O)c2c1 | | Class: | Phosphorylation | | Action: | Inhibitor | | Selectivity: | p56lck TK |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.6229±0.0756765 |
| Normalized OD Score: sc h |
0.7537±0.0610107 |
| Z-Score: |
-9.0490±1.77423 |
| p-Value: |
1.52204e-19 |
| Z-Factor: |
-0.579452 |
| Fitness Defect: |
43.3291 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 7|H3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04673125000000002±0.00247 | | Plate DMSO Control (-): | 0.7753±0.04573 | | Plate Z-Factor: | 0.8612 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 3220 |
1,6,8-trihydroxy-3-methyl-anthracene-9,10-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|
