| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017D07 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | BrC14H11O3 | | Molecular Weight: | 296.052 g/mol | | X log p: | 15.653 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1ccc(Br)cc1 |
| Species: |
4932 |
| Condition: |
wt18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2839±0.0763675 |
| Normalized OD Score: sc h |
0.3649±0.100575 |
| Z-Score: |
-17.7713±0.279382 |
| p-Value: |
0 |
| Z-Factor: |
0.431882 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|D7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.039749999999999994±0.00332 | | Plate DMSO Control (-): | 0.7671250000000001±0.01409 | | Plate Z-Factor: | 0.9341 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 689031 |
2-(4-bromophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| 2063466 |
2-(4-bromophenyl)-1-(2,4-dihydroxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|
