| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT010C02 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10Cl4H7NO2 | | Molecular Weight: | 307.923 g/mol | | X log p: | 9.897 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | NC(=CC(=O)c1cc(Cl)ccc1O)C(Cl)(Cl)Cl |
| Species: |
4932 |
| Condition: |
pdr24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0410±0.00106066 |
| Normalized OD Score: sc h |
0.0611±0.00293932 |
| Z-Score: |
-40.2489±1.08096 |
| p-Value: |
0 |
| Z-Factor: |
0.925629 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 10|C2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.00 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.042124999999999996±0.00351 | | Plate DMSO Control (-): | 0.6454249999999999±0.01317 | | Plate Z-Factor: | 0.9065 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 872088 |
(E)-3-amino-4,4,4-trichloro-1-(5-chloro-2-hydroxy-phenyl)but-2-en-1-one |
| 2852991 |
3-amino-4,4,4-trichloro-1-(5-chloro-2-hydroxy-phenyl)but-2-en-1-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 | |
|
