Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT010C02 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10Cl4H7NO2 | Molecular Weight: | 307.923 g/mol | X log p: | 9.897 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | NC(=CC(=O)c1cc(Cl)ccc1O)C(Cl)(Cl)Cl |
Species: |
4932 |
Condition: |
wt24h |
Replicates: |
2 |
Raw OD Value: r im |
0.3982±0.501268 |
Normalized OD Score: sc h |
0.5031±0.631377 |
Z-Score: |
-25.1588±33.2911 |
p-Value: |
0.0527864 |
Z-Factor: |
-2.92595 |
Fitness Defect: |
2.9415 |
Bioactivity Statement: |
Outlier |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 10|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.0393±0.00178 | Plate DMSO Control (-): | 0.7565500000000001±0.01360 | Plate Z-Factor: | 0.9432 |
| png ps pdf |
DBLink | Rows returned: 2 | |
872088 |
(E)-3-amino-4,4,4-trichloro-1-(5-chloro-2-hydroxy-phenyl)but-2-en-1-one |
2852991 |
3-amino-4,4,4-trichloro-1-(5-chloro-2-hydroxy-phenyl)but-2-en-1-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 | |
|