| Compound Information | SONAR Target prediction | | Name: | Homidium Bromide | | Unique Identifier: | LAT002G03 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | BrC21H21N3 | | Molecular Weight: | 374.149 g/mol | | X log p: | 22.536 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 3.01 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 |
| Species: |
4932 |
| Condition: |
pdr24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6428±0.019304 |
| Normalized OD Score: sc h |
0.8920±0.000531148 |
| Z-Score: |
-4.5440±0.102036 |
| p-Value: |
0.0000058329 |
| Z-Factor: |
0.471995 |
| Fitness Defect: |
12.052 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 2|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.040275000000000005±0.00205 | | Plate DMSO Control (-): | 0.692975±0.01342 | | Plate Z-Factor: | 0.9255 |
| png ps pdf |
| 11744000 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine iodide |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 | |
|