| Compound Information | SONAR Target prediction |
| Name: | Homidium Bromide |
| Unique Identifier: | LAT002G03 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | BrC21H21N3 |
| Molecular Weight: | 374.149 g/mol |
| X log p: | 22.536 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 3.01 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 2 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 |
| Found: 4 active | as graph: single | with analogs | 1 2 3 4 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3864±0.00544472 |
| Normalized OD Score: sc h | 0.6115±0.0101235 |
| Z-Score: | -10.8342±0.535851 |
| p-Value: | 6.93242e-26 |
| Z-Factor: | 0.728316 |
| Fitness Defect: | 57.931 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 7 | 1 2 Next >> |
| 3624 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
| 11765 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride |
| 14710 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide |
| 152350 | 5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine |
| 174724 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
| 3896235 | (8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01503806 | 1.0000 |
| nonactive | Cluster 6881 | Additional Members: 3 | Rows returned: 1 |
| SPE01503806 | 0 |
Service provided by the
Mike Tyers Laboratory