| 
 | Compound Information | SONAR Target prediction |  | Name: | Homidium Bromide |  | Unique Identifier: | LAT002G03 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | BrC21H21N3 |  | Molecular Weight: | 374.149 g/mol |  | X log p: | 22.536  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 3.01 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | wt24h |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7768±0.0118794 |  
		| Normalized OD Score: sc h | 0.9325±0.0131255 |  
		| Z-Score: | -2.9230±1.42103 |  
		| p-Value: | 0.027588 |  
		| Z-Factor: | -0.231875 |  
		| Fitness Defect: | 3.5904 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | LATCA |  | Plate Number and Position: | 2|G3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.40 Celcius |  | Date: | 2007-02-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.04±0.00274 |  | Plate DMSO Control (-): | 0.810125±0.01183 |  | Plate Z-Factor: | 0.9322 | 
 |  png ps
 pdf
 | 
 
 
	
		| 11744000 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine iodide |  
 | internal high similarity DBLink  | Rows returned: 1 |  | 
 
 | active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 |  | 
 
 |