| Compound Information | SONAR Target prediction | | Name: | | | Unique Identifier: | K788-6942 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | BrC24H17N4O2 | | Molecular Weight: | 456.187 g/mol | | X log p: | 26.829 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 65.34 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Brc1ccc2N(CC3=CC(=O)N4C=CC=CC4=N3)C(=O)CN=C(c3ccccc3)c2c1 |
| Species: |
4932 |
| Condition: |
tep1-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8406±0.0253144 |
| Normalized OD Score: sc h |
1.0020±0.020137 |
| Z-Score: |
0.0592±0.470053 |
| p-Value: |
0.740044 |
| Z-Factor: |
-21.7906 |
| Fitness Defect: |
0.301 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | ChemDiv-Kinase | | Plate Number and Position: | 13|E3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-08-16 YYYY-MM-DD | | Plate CH Control (+): | 0.04425±0.00190 | | Plate DMSO Control (-): | 0.7984±0.02460 | | Plate Z-Factor: | 0.9051 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 3645286 |
9-bromo-2-[(10-oxo-1,7-diazabicyclo[4.4.0]deca-2,4,6,8-tetraen-8-yl)methyl]-6-phenyl-2,5-diazabicyclo[5. 4.0]undeca-5,8,10,12-tetraen-3-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 12033 | Additional Members: 4 | Rows returned: 0 | |
|