Compound Information | SONAR Target prediction | Name: | | Unique Identifier: | K788-6942 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | BrC24H17N4O2 | Molecular Weight: | 456.187 g/mol | X log p: | 26.829 (online calculus) | Lipinksi Failures | 1 | TPSA | 65.34 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 3 | Canonical Smiles: | Brc1ccc2N(CC3=CC(=O)N4C=CC=CC4=N3)C(=O)CN=C(c3ccccc3)c2c1 |
Species: |
4932 |
Condition: |
gpr1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.8468±0.0356382 |
Normalized OD Score: sc h |
1.0175±0.025243 |
Z-Score: |
0.3950±0.573586 |
p-Value: |
0.707458 |
Z-Factor: |
-6.31591 |
Fitness Defect: |
0.3461 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | ChemDiv-Kinase | Plate Number and Position: | 13|E3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-08-16 YYYY-MM-DD | Plate CH Control (+): | 0.0444±0.00313 | Plate DMSO Control (-): | 0.82365±0.02882 | Plate Z-Factor: | 0.8909 |
| png ps pdf |
DBLink | Rows returned: 1 | |
3645286 |
9-bromo-2-[(10-oxo-1,7-diazabicyclo[4.4.0]deca-2,4,6,8-tetraen-8-yl)methyl]-6-phenyl-2,5-diazabicyclo[5. 4.0]undeca-5,8,10,12-tetraen-3-one |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 12033 | Additional Members: 4 | Rows returned: 1 | |
|