| Compound Information | SONAR Target prediction |
| Name: | VERAPAMIL HYDROCHLORIDE |
| Unique Identifier: | SPE02300307 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 451.753 g/mol |
| X log p: | 13.826 (online calculus) |
| Lipinksi Failures | 2 |
| TPSA | 63.95 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 13 |
| Canonical Smiles: | Cl.COc1ccc(CCN(C)CCCC(C#N)(C(C)C)c2ccc(OC)c(OC)c2)cc1OC |
| Source: | synthetic |
| Therapeutics: | adrenegic blocker, Ca channel blocker, coronary vasodilator, antiarrhythmic |
| Generic_name: | Verapamil |
| Chemical_iupac_name: | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-(1-methyleth yl)pentanenitrile |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA451868 |
| Kegg_compound_id: | C07188 |
| Drugbank_id: | APRD00335 |
| Melting_point: | < 25 oC |
| H2o_solubility: | 4.47 mg/L |
| Logp: | 5.931 |
| Isoelectric_point: | 8.92 |
| Cas_registry_number: | 52-53-9 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C52539&Index=0&Type=Mass&Large=on |
| Drug_category: | Vasodilator Agents; Antiarrhythmic Agents; Calcium-channel blocking agents; ATC:C08DA01 |
| Indication: | For the treatment of hypertension and angina. |
| Pharmacology: | Verapamil, a class IV antiarrhythmic agent, is used as a calcium-channel blocking (CCB) agent for the treatment of angina, hypertension, and for supraventricular tachyarrhythmias. |
| Mechanism_of_action: | Possibly by deforming the channel, inhibiting ion-control gating mechanisms, and/or interfering with the release of calcium from the sarcoplasmic reticulum, verapamil, like diltiazem, inhibits the influx of extracellular calcium across both the myocardial and vascular smooth muscle cell membranes. The resultant inhibition of the contractile processes of the myocardial smooth muscle cells leads to dilation of the coronary and systemic arteries,improved oxygen delivery to the myocardial tissue, and decreased total peripheral resistance, systemic blood pressure, and afterload. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 61 62 63 64 65 66 67 68 69 70 Next >> [205] |
| Species: | 4932 |
| Condition: | RAD23 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7185±0.00155563 |
| Normalized OD Score: sc h | 1.0165±0.000775724 |
| Z-Score: | 0.8474±0.0190335 |
| p-Value: | 0.396828 |
| Z-Factor: | -2.6472 |
| Fitness Defect: | 0.9243 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 17 | 1 2 3 Next >> |
| 2520 | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-pentanenitrile |
| 62969 | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-pentanenitrile hydrochloride |
| 65808 | (2R)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-pentanenitrile |
| 65832 | 2-(3,4-dimethoxyphenyl)-5-[2-(3-methoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-pentanenitrile |
| 92305 | (2S)-2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethyl-methyl-amino]-2-propan-2-yl-pentanenitrile |
| 104972 | 2-(3,4-dimethoxyphenyl)-5-[2-(3,4-dimethoxyphenyl)ethylamino]-2-propan-2-yl-pentanenitrile |
| internal high similarity DBLink | Rows returned: 3 |
| LOPAC 00208 | 0.9709 |
| LOPAC 00242 | 1.0000 |
| RJC 01232 | 1.0000 |
| nonactive | Cluster 3209 | Additional Members: 11 | Rows returned: 4 |
| LOPAC 00162 | 0.421052631578947 |
| LOPAC 00208 | 0.180327868852459 |
| LOPAC 00242 | 0 |
| Prest440 | 0 |
Service provided by the
Mike Tyers Laboratory