| Compound Information | SONAR Target prediction |
| Name: | LEVODOPA |
| Unique Identifier: | SPE02300205 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 186.101 g/mol |
| X log p: | 5.387 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 17.07 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | NC(Cc1ccc(O)c(O)c1)C(O)=O |
| Class: | amino acid |
| Source: | Vicia faba seedlings, Sarothamnus spp, & other palnts |
| Therapeutics: | antiparkinsonian |
| Generic_name: | Levodopa |
| Chemical_iupac_name: | 2-amino-3-(3,4-dihydroxyphenyl)-propanoic acid |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450213 |
| Kegg_compound_id: | C00355 |
| Drugbank_id: | APRD00309 |
| Melting_point: | 276-278 oC |
| H2o_solubility: | 5000 mg/L |
| Logp: | -2.244 |
| Isoelectric_point: | 2.32 |
| Cas_registry_number: | 59-92-7 |
| Mass_spectrum: | http://webbook.nist.gov/cgi/cbook.cgi?Spec=C59927&Index=0&Type=Mass&Large=on |
| Drug_category: | Dopamine Agents; Antiparkinson Agents; Antidyskinetics; ATC:N04BA01; ATC:N04BA04 |
| Indication: | For the treatment of idiopathic Parkinson-s disease (Paralysis Agitans), postencephalitic parkinsonism, symptomatic parkinsonism which may follow injury to the nervous system by carbon monoxide intoxication, and manganese intoxication. |
| Pharmacology: | Levodopa (L-dopa) is used to replace dopamine lost in Parkinson-s disease because dopamine itself cannot cross the blood-brain barrier where its precursor can. However, L-DOPA is converted to dopamine in the periphery as well as in the CNS, so it is administered with a peripheral DDC (dopamine decarboxylase) inhibitor such as carbidopa, without which 90% is metabolised in the gut wall, and with a COMT inhibitor if possible; this prevents about a 5% loss. The form given therapeutically is therefore a prodrug which avoids decarboxylation in the stomach and periphery, can cross the blood-brain barrier, and once in the brain is converted to the neurotransmitter dopamine by the enzyme aromatic-L-amino-acid decarboxylase. |
| Mechanism_of_action: | Striatal dopamine levels in symptomatic Parkinson-s disease are decreased by 60 to 80%, striatal dopaminergic neurotransmission may be enhanced by exogenous supplementation of dopamine through administration of dopamine-s precursor, levodopa. A small percentage of each levodopa dose crosses the blood-brain barrier and is decarboxylated to dopamine. This newly formed dopamine then is available to stimulate dopaminergic receptors, thus compensating for the depleted supply of endogenous dopamine. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | [1] << Back 71 72 73 74 75 76 77 78 79 80 Next >> [205] |
| Species: | 4932 |
| Condition: | PDE1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7933±0.0221324 |
| Normalized OD Score: sc h | 0.9891±0.0094809 |
| Z-Score: | -0.3980±0.356286 |
| p-Value: | 0.699802 |
| Z-Factor: | -5.21337 |
| Fitness Defect: | 0.357 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 18 | << Back 1 2 3 Next >> |
| 92222 | (2R)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| 450581 | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| 450884 | 2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| 721860 | (2R)-2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoic acid |
| 3083659 | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-2-methyl-propanoic acid hydrochloride |
| 6914094 | (2S)-2-amino-3-(2,3,6-trideuterio-4,5-dihydroxy-phenyl)propanoic acid |
| internal high similarity DBLink | Rows returned: 5 |
| RJC 01671 | 0.9474 |
| LOPAC 00283 | 1.0000 |
| LOPAC 00613 | 1.0000 |
| LOPAC 01063 | 1.0000 |
| SPE01500403 | 1.0000 |
| active | Cluster 12980 | Additional Members: 10 | Rows returned: 2 |
| SPE01502206 | 0.55 |
| LOPAC 01089 | 0.55 |
Service provided by the
Mike Tyers Laboratory