| Compound Information | SONAR Target prediction | | Name: | CHLORDIAZEPOXIDE | | Unique Identifier: | SPE01900004 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16ClH14N3O | | Molecular Weight: | 285.644 g/mol | | X log p: | 16.243 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.43 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | [O-][N+]1CC(NC)=Nc2ccc(Cl)cc2C=1c1ccccc1 | | Therapeutics: | minor tranquilzer, sedative |
| Species: |
4932 |
| Condition: |
TIF3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6016±0.00452548 |
| Normalized OD Score: sc h |
0.9877±0.00242601 |
| Z-Score: |
-0.5810±0.130603 |
| p-Value: |
0.562932 |
| Z-Factor: |
-6.76464 |
| Fitness Defect: |
0.5746 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2007-10-31 YYYY-MM-DD | | Plate CH Control (+): | 0.042125±0.00080 | | Plate DMSO Control (-): | 0.60535±0.01947 | | Plate Z-Factor: | 0.8803 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 19404 |
9-chloro-N,N-dimethyl-5-oxido-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
| 3000262 |
9-chloro-5-hydroxy-N-methyl-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3577 | Additional Members: 1 | Rows returned: 0 | |
|