Compound Information | SONAR Target prediction | Name: | CHLORDIAZEPOXIDE | Unique Identifier: | SPE01900004 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16ClH14N3O | Molecular Weight: | 285.644 g/mol | X log p: | 16.243 (online calculus) | Lipinksi Failures | 1 | TPSA | 38.43 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | [O-][N+]1CC(NC)=Nc2ccc(Cl)cc2C=1c1ccccc1 | Therapeutics: | minor tranquilzer, sedative |
Species: |
4932 |
Condition: |
ELG1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6870±0.00410122 |
Normalized OD Score: sc h |
0.9836±0.00628822 |
Z-Score: |
-1.0287±0.382842 |
p-Value: |
0.321136 |
Z-Factor: |
-3.20028 |
Fitness Defect: |
1.1359 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 23|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2007-10-10 YYYY-MM-DD | Plate CH Control (+): | 0.0399±0.00026 | Plate DMSO Control (-): | 0.695075±0.01340 | Plate Z-Factor: | 0.9381 |
| png ps pdf |
DBLink | Rows returned: 2 | |
19404 |
9-chloro-N,N-dimethyl-5-oxido-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
3000262 |
9-chloro-5-hydroxy-N-methyl-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3577 | Additional Members: 1 | Rows returned: 0 | |
|