| Compound Information | SONAR Target prediction | | Name: | CHLORDIAZEPOXIDE | | Unique Identifier: | SPE01900004 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16ClH14N3O | | Molecular Weight: | 285.644 g/mol | | X log p: | 16.243 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 38.43 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | [O-][N+]1CC(NC)=Nc2ccc(Cl)cc2C=1c1ccccc1 | | Therapeutics: | minor tranquilzer, sedative |
| Species: |
4932 |
| Condition: |
CDC73 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4006±0.0231224 |
| Normalized OD Score: sc h |
0.9505±0.00474785 |
| Z-Score: |
-1.2503±0.185195 |
| p-Value: |
0.215078 |
| Z-Factor: |
-7.5335 |
| Fitness Defect: |
1.5368 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|A3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2007-09-19 YYYY-MM-DD | | Plate CH Control (+): | 0.0399±0.00093 | | Plate DMSO Control (-): | 0.413125±0.03504 | | Plate Z-Factor: | 0.6734 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 19404 |
9-chloro-N,N-dimethyl-5-oxido-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
| 3000262 |
9-chloro-5-hydroxy-N-methyl-6-phenyl-2-aza-5-azoniabicyclo[5.4.0]undeca-2,5,8,10,12-pentaen-3-amine |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3577 | Additional Members: 1 | Rows returned: 0 | |
|