Compound Information | SONAR Target prediction | Name: | FREQUENTIN | Unique Identifier: | SPE01800170 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H20O4 | Molecular Weight: | 232.147 g/mol | X log p: | 9.547 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | CCCC=CC=CC1CC(O)C(O)C(=O)C1C=O | Source: | ex Penicillium frequentans | Reference: | Nature 167: 357 (1951); J Chem Soc 1959: 1662 |
Species: |
4932 |
Condition: |
GAS1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3198±0.062084 |
Normalized OD Score: sc h |
1.0375±0.0527113 |
Z-Score: |
0.4011±0.564769 |
p-Value: |
0.711036 |
Z-Factor: |
-13.5931 |
Fitness Defect: |
0.341 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|D11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.60 Celcius | Date: | 2006-01-20 YYYY-MM-DD | Plate CH Control (+): | 0.04235±0.00134 | Plate DMSO Control (-): | 0.3486±0.03483 | Plate Z-Factor: | 0.6162 |
| png ps pdf |
DBLink | Rows returned: 4 | |
99875 |
6-hepta-1,3-dienyl-3,4-dihydroxy-2-oxo-cyclohexane-1-carbaldehyde |
5461035 |
(1R,3R,4R)-6-[(1E,3E)-hepta-1,3-dienyl]-3,4-dihydroxy-2-oxo-cyclohexane-1-carbaldehyde |
6036812 |
6-[(1E,3E)-hepta-1,3-dienyl]-3,4-dihydroxy-2-oxo-cyclohexane-1-carbaldehyde |
6708655 |
(1R,3R,4R,6S)-6-hepta-1,3-dienyl-3,4-dihydroxy-2-oxo-cyclohexane-1-carbaldehyde |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 220 | Additional Members: 1 | Rows returned: 0 | |
|