Compound Information | SONAR Target prediction | Name: | ECHINOCYSTIC ACID | Unique Identifier: | SPE01800123 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 424.319 g/mol | X log p: | 0.342 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC1(C)CCC2(C(O)CC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C2C1)C(O)=O | Class: | triterpene | Source: | Echinocystis spp | Reference: | J Am Chem Soc 77: 3579 (1955); 79: 3525 (1957) |
Species: |
4932 |
Condition: |
SPE01500767 |
Replicates: |
2 |
Raw OD Value: r im |
0.2802±0 |
Normalized OD Score: sc h |
0.3638±0 |
Z-Score: |
-25.6952±0 |
p-Value: |
0 |
Z-Factor: |
0.898678 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.04125±0.00351 | Plate DMSO Control (-): | 0.7571±0.01626 | Plate Z-Factor: | 0.9170 |
| png ps pdf |
73309 |
(4aR,5R,6aS,6aS,6bR,8aS,10S,12aS,14bR)-5,10-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a, 10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
101810 |
(4aR,5R,6aS,6aS,6bR,8aR,9S,10S,12aR,14bR)-9-formyl-5,10-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6 a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
104361 |
(4aR,5R,6aS,6aS,6bR,8aR,9R,10S,12aR,14bR)-5,10-dihydroxy-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-1, 3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
3939968 |
5,10-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a -carboxylic acid |
4483642 |
9-formyl-5,10-dihydroxy-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropic ene-4a-carboxylic acid |
5318209 |
(4aS,6bR,10S,12aS,14bR)-4,10-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b -tetradecahydropicene-4a-carboxylic acid |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1623 | Additional Members: 8 | Rows returned: 4 | |
|