| Compound Information | SONAR Target prediction |  | Name: | ERGOSTA-7,22-DIEN-3-ONE |  | Unique Identifier: | SPE01800109  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.299 g/mol |  | X log p: | 8.157  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Fomes & Coriolis spp. |  | Reference: | J Chem Soc (C)1971:685 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SLT2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7790±0.00120208 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0276±0.0064231 | 
	 
	
		| Z-Score: | 
		1.3613±0.319387 | 
	 
	
		| p-Value: | 
		0.184345 | 
	 
	
		| Z-Factor: | 
		-1.13344 | 
	 
	
		| Fitness Defect: | 
		1.6909 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|E2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.10 Celcius |  | Date: | 2006-03-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.039375±0.00121 |  | Plate DMSO Control (-): | 0.7498750000000001±0.01062 |  | Plate Z-Factor: | 0.9421 |  
  |  png ps pdf |  
 
 
	
		| 27296 | 
		10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthre n-3-one | 
	 
	
		| 35821 | 
		4-(2,6,6-trimethyl-1-cyclohex-2-enyl)butan-2-one | 
	 
	
		| 85784 | 
		n/a | 
	 
	
		| 103743 | 
		1-(8,8-dimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)ethanone | 
	 
	
		| 108809 | 
		n/a | 
	 
	
		| 109194 | 
		1-(2,3,8,8-tetramethyl-1,3,4,6,7,8a-hexahydronaphthalen-2-yl)ethanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |