| Compound Information | SONAR Target prediction | | Name: | ERGOSTA-7,22-DIEN-3-ONE | | Unique Identifier: | SPE01800109 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.299 g/mol | | X log p: | 8.157 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Fomes & Coriolis spp. | | Reference: | J Chem Soc (C)1971:685 |
| Species: |
4932 |
| Condition: |
ARP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7407±0.00601041 |
| Normalized OD Score: sc h |
1.0200±0.00148444 |
| Z-Score: |
1.0123±0.152137 |
| p-Value: |
0.3142 |
| Z-Factor: |
-1.03175 |
| Fitness Defect: |
1.1577 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.80 Celcius | | Date: | 2006-03-23 YYYY-MM-DD | | Plate CH Control (+): | 0.039825±0.00165 | | Plate DMSO Control (-): | 0.7226250000000001±0.00953 | | Plate Z-Factor: | 0.9427 |
| png ps pdf |
| 27296 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthre n-3-one |
| 35821 |
4-(2,6,6-trimethyl-1-cyclohex-2-enyl)butan-2-one |
| 85784 |
n/a |
| 103743 |
1-(8,8-dimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)ethanone |
| 108809 |
n/a |
| 109194 |
1-(2,3,8,8-tetramethyl-1,3,4,6,7,8a-hexahydronaphthalen-2-yl)ethanone |
| internal high similarity DBLink | Rows returned: 5 | |
| nonactive | Cluster 5085 | Additional Members: 3 | Rows returned: 2 | |
|