| 
 | Compound Information | SONAR Target prediction |  | Name: | ERGOSTA-7,22-DIEN-3-ONE |  | Unique Identifier: | SPE01800109 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.299 g/mol |  | X log p: | 8.157  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Fomes & Coriolis spp. |  | Reference: | J Chem Soc (C)1971:685 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | PRE9 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6420±0.0127986 |  
		| Normalized OD Score: sc h | 1.0005±0.000382348 |  
		| Z-Score: | 0.0207±0.014792 |  
		| p-Value: | 0.983524 |  
		| Z-Factor: | -10.9781 |  
		| Fitness Defect: | 0.0166 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|E2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.70 Celcius |  | Date: | 2007-10-04 YYYY-MM-DD |  | Plate CH Control (+): | 0.0398±0.00036 |  | Plate DMSO Control (-): | 0.6257999999999999±0.04223 |  | Plate Z-Factor: | 0.7754 | 
 |  png ps
 pdf
 | 
 
 
	
		| 1715396 | (5S,9S,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-1,2,5,6,9,11,12,15,16, 17-decahydrocyclopenta[a]phenanthren-3-one
 |  
		| 2748213 | (14S)-10,13-dimethyl-1,2,4,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |  
		| 2748251 | (5R,14S)-10,13-dimethyl-1,2,4,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |  
		| 3017532 | 3-methyl-4-(2,6,6-trimethyl-1-cyclohex-2-enyl)butan-2-one |  
		| 3036241 | (10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,5,6,7,11,12,15,16,17-dec ahydrocyclopenta[a]phenanthren-3-one
 |  
		| 3259771 | 17-acetyl-4,4,10,13,14-pentamethyl-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |