Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
UBP8 |
Replicates: |
2 |
Raw OD Value: r im |
0.6378±0.0222739 |
Normalized OD Score: sc h |
0.9862±0.0050556 |
Z-Score: |
-0.5670±0.208619 |
p-Value: |
0.574894 |
Z-Factor: |
-358.816 |
Fitness Defect: |
0.5536 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|E2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2007-10-17 YYYY-MM-DD | Plate CH Control (+): | 0.03985±0.00349 | Plate DMSO Control (-): | 0.640525±0.03635 | Plate Z-Factor: | 0.7903 |
| png ps pdf |
579157 |
2-methyl-4-(2,6,6-trimethyl-1-cyclohexenyl)butanal |
579168 |
4-(2,6,6-trimethyl-1-cyclohex-2-enyl)pentan-2-one |
595401 |
n/a |
609687 |
4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-one |
618607 |
4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,7,8,9,10,11,12,12a,13,14,14a-tetradecahydropicen-3-one |
621255 |
1,1,4a,7,7-pentamethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|