| 
 | Compound Information | SONAR Target prediction |  | Name: | ERGOSTA-7,22-DIEN-3-ONE |  | Unique Identifier: | SPE01800109 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.299 g/mol |  | X log p: | 8.157  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Fomes & Coriolis spp. |  | Reference: | J Chem Soc (C)1971:685 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | RNR3 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7815±0.0216375 |  
		| Normalized OD Score: sc h | 1.0100±0.0105472 |  
		| Z-Score: | 0.2848±0.286935 |  
		| p-Value: | 0.78021 |  
		| Z-Factor: | -8.92052 |  
		| Fitness Defect: | 0.2482 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 9|E2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2006-04-26 YYYY-MM-DD |  | Plate CH Control (+): | 0.038125±0.00124 |  | Plate DMSO Control (-): | 0.747425±0.03544 |  | Plate Z-Factor: | 0.8527 | 
 |  png ps
 pdf
 | 
 
 
	
		| 579157 | 2-methyl-4-(2,6,6-trimethyl-1-cyclohexenyl)butanal |  
		| 579168 | 4-(2,6,6-trimethyl-1-cyclohex-2-enyl)pentan-2-one |  
		| 595401 | n/a |  
		| 609687 | 4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro-1H-picen-3-one |  
		| 618607 | 4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,7,8,9,10,11,12,12a,13,14,14a-tetradecahydropicen-3-one |  
		| 621255 | 1,1,4a,7,7-pentamethyl-3,4,4b,5,6,8,10,10a-octahydrophenanthren-2-one |  
 | internal high similarity DBLink  | Rows returned: 5 |  | 
 
 | active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  | 
 
 |