Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
MSN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6736±0.0059397 |
Normalized OD Score: sc h |
1.0076±0.00221219 |
Z-Score: |
0.3639±0.0897172 |
p-Value: |
0.716514 |
Z-Factor: |
-5.85364 |
Fitness Defect: |
0.3334 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2008-02-29 YYYY-MM-DD | Plate CH Control (+): | 0.04035±0.00062 | Plate DMSO Control (-): | 0.658525±0.01309 | Plate Z-Factor: | 0.9350 |
| png ps pdf |
556274 |
2-(6-bicyclo[2.2.1]hept-2-enyl)acetaldehyde |
556372 |
3-(1-cyclopent-2-enyl)propanal |
564293 |
4-(2,7,7-trimethyl-1-bicyclo[3.2.0]hept-2-enyl)butan-2-one |
564529 |
4-propan-2-yl-1,3,3a,4,7,7a-hexahydroinden-2-one |
565525 |
4-(1,2-dimethyl-1-cyclopent-2-enyl)butan-2-one |
578142 |
1-(7-bicyclo[3.3.1]non-3-enyl)-2-methyl-propan-1-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|