Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
KGD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7115±0.0196576 |
Normalized OD Score: sc h |
1.0097±0.00410298 |
Z-Score: |
0.5740±0.249372 |
p-Value: |
0.571976 |
Z-Factor: |
-7.52238 |
Fitness Defect: |
0.5587 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|E2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.00 Celcius | Date: | 2007-09-11 YYYY-MM-DD | Plate CH Control (+): | 0.03945±0.00037 | Plate DMSO Control (-): | 0.696825±0.02320 | Plate Z-Factor: | 0.8817 |
| png ps pdf |
535365 |
10,13-dimethyl-1,4,5,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
536974 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenant hren-3-one |
537045 |
10,13,14-trimethyl-17-(6-methylheptan-2-yl)-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthr en-3-one |
541353 |
4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phena nthren-3-one |
548712 |
n/a |
556249 |
1,3,3a,4,7,7a-hexahydroinden-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|