Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
REF2 |
Replicates: |
2 |
Raw OD Value: r im |
0.3891±0.00685894 |
Normalized OD Score: sc h |
0.9280±0.0196899 |
Z-Score: |
-2.0873±0.584702 |
p-Value: |
0.053275 |
Z-Factor: |
-1.12075 |
Fitness Defect: |
2.9323 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2008-08-27 YYYY-MM-DD | Plate CH Control (+): | 0.042525±0.00054 | Plate DMSO Control (-): | 0.37665000000000004±0.01059 | Plate Z-Factor: | 0.9259 |
| png ps pdf |
535365 |
10,13-dimethyl-1,4,5,6,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
536974 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenant hren-3-one |
537045 |
10,13,14-trimethyl-17-(6-methylheptan-2-yl)-2,4,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthr en-3-one |
541353 |
4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-2,5,6,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phena nthren-3-one |
548712 |
n/a |
556249 |
1,3,3a,4,7,7a-hexahydroinden-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|