Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
GCN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.2830±0.0248902 |
Normalized OD Score: sc h |
0.9851±0.0266155 |
Z-Score: |
-0.2570±0.457988 |
p-Value: |
0.754022 |
Z-Factor: |
-33.9868 |
Fitness Defect: |
0.2823 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|E2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2007-10-30 YYYY-MM-DD | Plate CH Control (+): | 0.040975±0.00056 | Plate DMSO Control (-): | 0.2904±0.03743 | Plate Z-Factor: | 0.5351 |
| png ps pdf |
296097 |
1-(7-bicyclo[3.3.1]non-3-enyl)ethanone |
314388 |
17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-one |
440345 |
(4S,5S,9R,10R,13S,14R,17R)-4,10,13-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,4,5,6,9,11,12,14,15,16,17 -dodecahydrocyclopenta[a]phenanthren-3-one |
520440 |
2-(4-methyl-1-cyclohex-3-enyl)propanal |
524201 |
2-(3-methyl-1-cyclohex-3-enyl)propanal |
534298 |
4a-methyl-1,3,4,5,8,8a-hexahydronaphthalen-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|