Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
DOA4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6362±0.0100409 |
Normalized OD Score: sc h |
0.9973±0.0181595 |
Z-Score: |
-0.1148±0.716446 |
p-Value: |
0.614768 |
Z-Factor: |
-14.6067 |
Fitness Defect: |
0.4865 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-05-02 YYYY-MM-DD | Plate CH Control (+): | 0.040525±0.00040 | Plate DMSO Control (-): | 0.6138250000000001±0.01402 | Plate Z-Factor: | 0.9258 |
| png ps pdf |
DBLink | Rows returned: 124 | << Back 21 |
11776133 |
n/a |
11875006 |
(4aR,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one |
11875007 |
(4aS,6aS,6bS,8aR,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one |
16069676 |
(4aS,8aR)-4a-methyl-1,3,4,7,8,8a-hexahydronaphthalen-2-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|