| Compound Information | SONAR Target prediction | | Name: | ERGOSTA-7,22-DIEN-3-ONE | | Unique Identifier: | SPE01800109 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.299 g/mol | | X log p: | 8.157 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Fomes & Coriolis spp. | | Reference: | J Chem Soc (C)1971:685 |
| Species: |
4932 |
| Condition: |
COT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7033±0.00388909 |
| Normalized OD Score: sc h |
1.0132±0.0103653 |
| Z-Score: |
0.6893±0.54607 |
| p-Value: |
0.521972 |
| Z-Factor: |
-14.7091 |
| Fitness Defect: |
0.6501 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.80 Celcius | | Date: | 2007-11-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040475±0.00072 | | Plate DMSO Control (-): | 0.686875±0.03156 | | Plate Z-Factor: | 0.9069 |
|  png
ps
pdf |
| 109302 |
1-(3,5,5-trimethyl-2,3,4,4a,6,8a-hexahydro-1H-naphthalen-2-yl)propan-1-one |
| 109420 |
1-(2,6,6-trimethyl-1-cyclohex-2-enyl)pentan-3-one |
| 141764 |
n/a |
| 142059 |
n/a |
| 162285 |
4-(7,7-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)butanal |
| 185590 |
n/a |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|
