| Compound Information | SONAR Target prediction | | Name: | ERGOSTA-7,22-DIEN-3-ONE | | Unique Identifier: | SPE01800109 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.299 g/mol | | X log p: | 8.157 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Fomes & Coriolis spp. | | Reference: | J Chem Soc (C)1971:685 |
| Species: |
4932 |
| Condition: |
RAD50 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6493±0.0150614 |
| Normalized OD Score: sc h |
1.0101±0.00148434 |
| Z-Score: |
0.4020±0.0516188 |
| p-Value: |
0.687908 |
| Z-Factor: |
-9.63036 |
| Fitness Defect: |
0.3741 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2007-09-07 YYYY-MM-DD | | Plate CH Control (+): | 0.0414±0.00100 | | Plate DMSO Control (-): | 0.6354500000000001±0.02579 | | Plate Z-Factor: | 0.8612 |
| png ps pdf |
| 6572562 |
(5R,8R,10R,13S,14R,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]ph enanthren-3-one |
| 6710685 |
(10R,13S,17R)-17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocy clopenta[a]phenanthren-3-one |
| 6857786 |
(10R,13S,17R)-17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-3-one |
| 6915980 |
n/a |
| 7001019 |
(4aS,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one |
| 7001020 |
(4aR,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|