| Compound Information | SONAR Target prediction |  | Name: | ERGOSTA-7,22-DIEN-3-ONE |  | Unique Identifier: | SPE01800109  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.299 g/mol |  | X log p: | 8.157  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Fomes & Coriolis spp. |  | Reference: | J Chem Soc (C)1971:685 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BEM2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4705±0.00183848 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0067±0.0103346 | 
	 
	
		| Z-Score: | 
		1.6214±0.625385 | 
	 
	
		| p-Value: | 
		0.138676 | 
	 
	
		| Z-Factor: | 
		-2.7559 | 
	 
	
		| Fitness Defect: | 
		1.9756 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 24|F2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.70 Celcius |  | Date: | 2008-02-05 YYYY-MM-DD |  | Plate CH Control (+): | 0.041699999999999994±0.00216 |  | Plate DMSO Control (-): | 0.462875±0.01623 |  | Plate Z-Factor: | 0.8860 |  
  |  png ps pdf |  
 
 
	
		| 6572562 | 
		(5R,8R,10R,13S,14R,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,12,14,15,16,17-dodecahydrocyclopenta[a]ph enanthren-3-one | 
	 
	
		| 6710685 | 
		(10R,13S,17R)-17-(5,6-dimethylhept-3-en-2-yl)-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocy clopenta[a]phenanthren-3-one | 
	 
	
		| 6857786 | 
		(10R,13S,17R)-17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahyd rocyclopenta[a]phenanthren-3-one | 
	 
	
		| 6915980 | 
		n/a | 
	 
	
		| 7001019 | 
		(4aS,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one | 
	 
	
		| 7001020 | 
		(4aR,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |