Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
RPN10 |
Replicates: |
2 |
Raw OD Value: r im |
0.7010±0.0153442 |
Normalized OD Score: sc h |
1.0108±0.00830165 |
Z-Score: |
0.5481±0.42742 |
p-Value: |
0.600456 |
Z-Factor: |
-7.69928 |
Fitness Defect: |
0.5101 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|E2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-09-28 YYYY-MM-DD | Plate CH Control (+): | 0.0416±0.00156 | Plate DMSO Control (-): | 0.68555±0.03090 | Plate Z-Factor: | 0.8441 |
| png ps pdf |
6442030 |
(5E)-3-methylcyclohexadec-5-en-1-one |
6442403 |
(E)-henicos-6-en-11-one |
6506221 |
(5E)-cyclohexadec-5-en-1-one |
6506496 |
(5E)-3-methylcyclohexadec-5-en-1-one |
6566086 |
(5R,9R,10R,13S,14S,17R)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methylhept-5-en-2-yl]-1,2,5,6,9,11,12,15,16, 17-decahydrocyclopenta[a]phenanthren-3-one |
6568581 |
(4aS,6aS,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-2,4a,5,6,7,8,9,10,12,12a,13,14-dodecahydro -1H-picen-3-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|