| Compound Information | SONAR Target prediction | | Name: | ERGOSTA-7,22-DIEN-3-ONE | | Unique Identifier: | SPE01800109 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 352.299 g/mol | | X log p: | 8.157 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | | Class: | sterol | | Source: | Fomes & Coriolis spp. | | Reference: | J Chem Soc (C)1971:685 |
| Species: |
4932 |
| Condition: |
BY4741-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8144±0.00869741 |
| Normalized OD Score: sc h |
1.0134±0.00291828 |
| Z-Score: |
0.8578±0.0850129 |
| p-Value: |
0.391842 |
| Z-Factor: |
-1.49243 |
| Fitness Defect: |
0.9369 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 9|E2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2006-04-05 YYYY-MM-DD | | Plate CH Control (+): | 0.0386±0.00128 | | Plate DMSO Control (-): | 0.7887250000000001±0.01421 | | Plate Z-Factor: | 0.9366 |
|  png
ps
pdf |
| 5743081 |
n/a |
| 5748344 |
(9R,10R,13S,14R,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16
,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| 6100688 |
n/a |
| 6428349 |
1-[(2R,8R,8aS)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]ethanone |
| 6436804 |
(9R,10R,13S,14R,17R)-17-[(E,2S,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16
,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| 6437472 |
2-[(E)-hex-3-enyl]cyclopentan-1-one |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|
