| Compound Information | SONAR Target prediction |  | Name: | ERGOSTA-7,22-DIEN-3-ONE |  | Unique Identifier: | SPE01800109  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 352.299 g/mol |  | X log p: | 8.157  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 1 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C |  | Class: | sterol |  | Source: | Fomes & Coriolis spp. |  | Reference: | J Chem Soc (C)1971:685 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ABP1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6933±0.00106066 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0026±0.00121772 | 
	 
	
		| Z-Score: | 
		0.1255±0.053211 | 
	 
	
		| p-Value: | 
		0.900164 | 
	 
	
		| Z-Factor: | 
		-33.5072 | 
	 
	
		| Fitness Defect: | 
		0.1052 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 24|F2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2007-12-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.041800000000000004±0.00083 |  | Plate DMSO Control (-): | 0.672275±0.01322 |  | Plate Z-Factor: | 0.9357 |  
  |  png ps pdf |  
 
 
	
		| 5364566 | 
		17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclope nta[a]phenanthren-3-one | 
	 
	
		| 5364717 | 
		(E)-henicos-6-en-11-one | 
	 
	
		| 5365655 | 
		1-[(4E)-1-cyclooct-4-enyl]propan-1-one | 
	 
	
		| 5369117 | 
		1-[(4E)-1-cyclooct-4-enyl]ethanone | 
	 
	
		| 5377822 | 
		17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a ]phenanthren-3-one | 
	 
	
		| 5487443 | 
		(5R,9R,10R,13S,14R,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15 ,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 |  |   
 
 |