Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
SDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7181±0.00120208 |
Normalized OD Score: sc h |
1.0029±0.00619104 |
Z-Score: |
0.1621±0.34842 |
p-Value: |
0.807886 |
Z-Factor: |
-31.7762 |
Fitness Defect: |
0.2133 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2008-04-18 YYYY-MM-DD | Plate CH Control (+): | 0.04215±0.00057 | Plate DMSO Control (-): | 0.707475±0.01547 | Plate Z-Factor: | 0.9227 |
| png ps pdf |
5314369 |
2-(2,5,5-trimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-yl)acetaldehyde |
5316264 |
(5E)-cyclopentadec-5-en-1-one |
5316269 |
(5E)-cyclotetradec-5-en-1-one |
5317961 |
n/a |
5319770 |
n/a |
5321508 |
(10R,13S)-17-[(E)-5-ethyl-6-methyl-hept-3-en-2-yl]-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahy drocyclopenta[a]phenanthren-3-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|