Compound Information | SONAR Target prediction | Name: | ERGOSTA-7,22-DIEN-3-ONE | Unique Identifier: | SPE01800109 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 352.299 g/mol | X log p: | 8.157 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(=O)CCC4(C)C3CCC12C | Class: | sterol | Source: | Fomes & Coriolis spp. | Reference: | J Chem Soc (C)1971:685 |
Species: |
4932 |
Condition: |
SNC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7166±0.00933381 |
Normalized OD Score: sc h |
1.0010±0.001358 |
Z-Score: |
0.0460±0.0739244 |
p-Value: |
0.958356 |
Z-Factor: |
-29.1659 |
Fitness Defect: |
0.0425 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 24|F2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.00 Celcius | Date: | 2008-04-24 YYYY-MM-DD | Plate CH Control (+): | 0.040975±0.00078 | Plate DMSO Control (-): | 0.710875±0.01855 | Plate Z-Factor: | 0.9096 |
| png ps pdf |
4338833 |
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,4,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenan thren-3-one |
4426421 |
1,1,4,4-tetramethyl-4a,5,8,8a-tetrahydro-3H-naphthalen-2-one |
4585785 |
1-(6-bicyclo[2.2.1]hept-2-enyl)propan-2-one |
4589999 |
n/a |
5059829 |
n/a |
5201677 |
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenan thren-3-one |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 5085 | Additional Members: 3 | Rows returned: 1 | |
|